C46H57N3O8 — CID 91344789
2-[(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]ethoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 91344789) has the molecular formula C46H57N3O8 and a molecular weight of 779.98 g/mol. Its IUPAC name is 2-[(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]ethoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | 2-[(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]ethoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 91344789 |
| Molecular Formula | C46H57N3O8 |
| Molecular Weight | 779.98 g/mol |
| Exact Mass | 779.41 |
| IUPAC Name | 2-[(2S)-2-azido-2-[(4S,5R)-2,2-dimethyl-5-pentyl-1,3-dioxolan-4-yl]ethoxy]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CCCCC[C@H]1OC(C)(C)O[C@H]1[C@H](COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C46H57N3O8/c1-4-5-10-27-39-41(57-46(2,3)56-39)38(48-49-47)32-54-45-44(53-31-37-25-17-9-18-26-37)43(52-30-36-23-15-8-16-24-36)42(51-29-35-21-13-7-14-22-35)40(55-45)33-50-28-34-19-11-6-12-20-34/h6-9,11-26,38-45H,4-5,10,27-33H2,1-3H3/t38-,39+,40?,41-,42?,43?,44?,45?/m0/s1 |
| InChIKey | JEHITOMLJHMIOQ-PTISBYMDSA-N |
| XLogP | 9.48 |
| TPSA | 122.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.98 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|