C43H53NO8 — CID 134389557
(1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanamine (PubChem CID 134389557) has the molecular formula C43H53NO8 and a molecular weight of 711.90 g/mol. Its IUPAC name is (1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanamine.
| Compound Name | (1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanamine |
|---|---|
| PubChem CID | 134389557 |
| Molecular Formula | C43H53NO8 |
| Molecular Weight | 711.90 g/mol |
| Exact Mass | 711.38 |
| IUPAC Name | (1S)-1-[(4S,5R)-5-ethyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyethanamine |
| SMILES | CC[C@H]1OC(C)(C)O[C@H]1[C@@H](N)COC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C43H53NO8/c1-4-36-38(52-43(2,3)51-36)35(44)29-49-42-41(48-28-34-23-15-8-16-24-34)40(47-27-33-21-13-7-14-22-33)39(46-26-32-19-11-6-12-20-32)37(50-42)30-45-25-31-17-9-5-10-18-31/h5-24,35-42H,4,25-30,44H2,1-3H3/t35-,36+,37?,38-,39?,40?,41?,42?/m0/s1 |
| InChIKey | MHEKMIZHOUQLNX-TVOAJWPQSA-N |
| XLogP | 6.96 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.90 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |