C23H36O4 — CID 10619567
(4S,5S)-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-5-[(Z)-non-1-enyl]-1,3-dioxolane (PubChem CID 10619567) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (4S,5S)-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-5-[(Z)-non-1-enyl]-1,3-dioxolane.
| Compound Name | (4S,5S)-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-5-[(Z)-non-1-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10619567 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (4S,5S)-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-5-[(Z)-non-1-enyl]-1,3-dioxolane |
| SMILES | CCCCCCC/C=C\[C@@H]1OC(C)(C)O[C@H]1COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H36O4/c1-5-6-7-8-9-10-11-12-21-22(27-23(2,3)26-21)18-25-17-19-13-15-20(24-4)16-14-19/h11-16,21-22H,5-10,17-18H2,1-4H3/b12-11-/t21-,22-/m0/s1 |
| InChIKey | PDFJOLIGLNMFGE-POJYLLKHSA-N |
| XLogP | 5.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|