C23H36O5 — CID 11003716
(2S)-2-[(4R,5R)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-2-[(4-methoxyphenyl)methoxy]ethanol (PubChem CID 11003716) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2S)-2-[(4R,5R)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-2-[(4-methoxyphenyl)methoxy]ethanol.
| Compound Name | (2S)-2-[(4R,5R)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-2-[(4-methoxyphenyl)methoxy]ethanol |
|---|---|
| PubChem CID | 11003716 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (2S)-2-[(4R,5R)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-2-[(4-methoxyphenyl)methoxy]ethanol |
| SMILES | CCCCC/C=C\C[C@H]1OC(C)(C)O[C@H]1[C@H](CO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H36O5/c1-5-6-7-8-9-10-11-20-22(28-23(2,3)27-20)21(16-24)26-17-18-12-14-19(25-4)15-13-18/h9-10,12-15,20-22,24H,5-8,11,16-17H2,1-4H3/b10-9-/t20-,21+,22-/m1/s1 |
| InChIKey | SLEYJBBPNRKDLJ-BFYQBTLMSA-N |
| XLogP | 4.62 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|