C15H22O3 — CID 102348878
(3S)-3-[(2S)-2-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyloxirane (PubChem CID 102348878) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3S)-3-[(2S)-2-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyloxirane.
| Compound Name | (3S)-3-[(2S)-2-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 102348878 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3S)-3-[(2S)-2-[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyloxirane |
| SMILES | COc1ccc(CO[C@@H](C)C[C@@H]2OC2(C)C)cc1 |
| InChI | InChI=1S/C15H22O3/c1-11(9-14-15(2,3)18-14)17-10-12-5-7-13(16-4)8-6-12/h5-8,11,14H,9-10H2,1-4H3/t11-,14-/m0/s1 |
| InChIKey | HNKOKJSZNBXNCT-FZMZJTMJSA-N |
| XLogP | 3.17 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|