C23H34O7 — CID 10835997
2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde (PubChem CID 10835997) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 10835997 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-[(4S,5S)-5-[(E,3S,5R)-3-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetaldehyde |
| SMILES | COCO[C@H](/C=C/[C@@H]1OC(C)(C)O[C@H]1CC=O)C[C@@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H34O7/c1-17(27-15-18-6-8-19(26-5)9-7-18)14-20(28-16-25-4)10-11-21-22(12-13-24)30-23(2,3)29-21/h6-11,13,17,20-22H,12,14-16H2,1-5H3/b11-10+/t17-,20-,21+,22+/m1/s1 |
| InChIKey | DCQWUBGNIGNIGI-IVPHTKSOSA-N |
| XLogP | 3.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|