C31H46O8 — CID 102351377
[(4R,5R)-5-[(E)-4-[(2S,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-2-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-2-yl]but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 102351377) has the molecular formula C31H46O8 and a molecular weight of 546.70 g/mol. Its IUPAC name is [(4R,5R)-5-[(E)-4-[(2S,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-2-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-2-yl]but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5R)-5-[(E)-4-[(2S,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-2-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-2-yl]but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 102351377 |
| Molecular Formula | C31H46O8 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | [(4R,5R)-5-[(E)-4-[(2S,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-2-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-2-yl]but-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C#CC[C@@H](C)[C@@H](OCc1ccc(OC)cc1)[C@H](OCOC)[C@@H]1CC[C@H](CC/C=C/[C@H]2OC(C)(C)O[C@@H]2CO)O1 |
| InChI | InChI=1S/C31H46O8/c1-7-10-22(2)29(35-20-23-13-15-24(34-6)16-14-23)30(36-21-33-5)27-18-17-25(37-27)11-8-9-12-26-28(19-32)39-31(3,4)38-26/h1,9,12-16,22,25-30,32H,8,10-11,17-21H2,2-6H3/b12-9+/t22-,25+,26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | NRZGMXRNYHQTPG-PSEMBFTQSA-N |
| XLogP | 4.63 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|