C26H34O3Si — CID 102152953
(3R,4S,5R,6R)-3-[dimethyl(phenyl)silyl]-5-[(4-methoxyphenyl)methoxy]-6-methylnon-1-en-8-yn-4-ol (PubChem CID 102152953) has the molecular formula C26H34O3Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3-[dimethyl(phenyl)silyl]-5-[(4-methoxyphenyl)methoxy]-6-methylnon-1-en-8-yn-4-ol.
| Compound Name | (3R,4S,5R,6R)-3-[dimethyl(phenyl)silyl]-5-[(4-methoxyphenyl)methoxy]-6-methylnon-1-en-8-yn-4-ol |
|---|---|
| PubChem CID | 102152953 |
| Molecular Formula | C26H34O3Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (3R,4S,5R,6R)-3-[dimethyl(phenyl)silyl]-5-[(4-methoxyphenyl)methoxy]-6-methylnon-1-en-8-yn-4-ol |
| SMILES | C#CC[C@@H](C)[C@@H](OCc1ccc(OC)cc1)[C@H](O)[C@@H](C=C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H34O3Si/c1-7-12-20(3)26(29-19-21-15-17-22(28-4)18-16-21)25(27)24(8-2)30(5,6)23-13-10-9-11-14-23/h1,8-11,13-18,20,24-27H,2,12,19H2,3-6H3/t20-,24-,25-,26-/m1/s1 |
| InChIKey | FEDHOYFMXISTQN-XTKIHQQCSA-N |
| XLogP | 4.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|