C19H26O4 — CID 102109955
(3R,4S)-4-[(2S,3S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-en-2-yl]-3-methyloxetan-2-one (PubChem CID 102109955) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (3R,4S)-4-[(2S,3S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-en-2-yl]-3-methyloxetan-2-one.
| Compound Name | (3R,4S)-4-[(2S,3S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-en-2-yl]-3-methyloxetan-2-one |
|---|---|
| PubChem CID | 102109955 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3R,4S)-4-[(2S,3S)-3-[(4-methoxyphenyl)methoxy]-4-methylhex-5-en-2-yl]-3-methyloxetan-2-one |
| SMILES | C=CC(C)[C@H](OCc1ccc(OC)cc1)[C@H](C)[C@@H]1OC(=O)[C@@H]1C |
| InChI | InChI=1S/C19H26O4/c1-6-12(2)17(13(3)18-14(4)19(20)23-18)22-11-15-7-9-16(21-5)10-8-15/h6-10,12-14,17-18H,1,11H2,2-5H3/t12?,13-,14+,17-,18-/m0/s1 |
| InChIKey | CFWMCEDJYRFJNZ-WGMSZMBKSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|