C15H22O3 — CID 140533860
(1S)-1-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-en-1-ol (PubChem CID 140533860) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S)-1-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-en-1-ol.
| Compound Name | (1S)-1-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-en-1-ol |
|---|---|
| PubChem CID | 140533860 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1S)-1-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-en-1-ol |
| SMILES | C=CCC(C)(C)[C@@H](O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H22O3/c1-5-10-15(2,3)14(16)18-11-12-6-8-13(17-4)9-7-12/h5-9,14,16H,1,10-11H2,2-4H3/t14-/m0/s1 |
| InChIKey | VSEXYLNSDJMMTQ-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|