C17H24O3 — CID 10869554
(2E,5S)-5-[(4-methoxyphenyl)methoxy]-4,4-dimethylhepta-2,6-dien-1-ol (PubChem CID 10869554) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2E,5S)-5-[(4-methoxyphenyl)methoxy]-4,4-dimethylhepta-2,6-dien-1-ol.
| Compound Name | (2E,5S)-5-[(4-methoxyphenyl)methoxy]-4,4-dimethylhepta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 10869554 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2E,5S)-5-[(4-methoxyphenyl)methoxy]-4,4-dimethylhepta-2,6-dien-1-ol |
| SMILES | C=C[C@H](OCc1ccc(OC)cc1)C(C)(C)/C=C/CO |
| InChI | InChI=1S/C17H24O3/c1-5-16(17(2,3)11-6-12-18)20-13-14-7-9-15(19-4)10-8-14/h5-11,16,18H,1,12-13H2,2-4H3/b11-6+/t16-/m0/s1 |
| InChIKey | DFMWZPCULKNLFO-RFKZRZAASA-N |
| XLogP | 3.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|