C18H27ClO5S — CID 86628872
[(3S)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate (PubChem CID 86628872) has the molecular formula C18H27ClO5S and a molecular weight of 390.93 g/mol. Its IUPAC name is [(3S)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate.
| Compound Name | [(3S)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate |
|---|---|
| PubChem CID | 86628872 |
| Molecular Formula | C18H27ClO5S |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [(3S)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl] 3-chloropropane-1-sulfonate |
| SMILES | C=C[C@H](OCc1ccc(OC)cc1)C(C)(C)COS(=O)(=O)CCCCl |
| InChI | InChI=1S/C18H27ClO5S/c1-5-17(23-13-15-7-9-16(22-4)10-8-15)18(2,3)14-24-25(20,21)12-6-11-19/h5,7-10,17H,1,6,11-14H2,2-4H3/t17-/m0/s1 |
| InChIKey | MLTWKJDOOPHRHW-KRWDZBQOSA-N |
| XLogP | 3.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|