C16H24ClNO3S — CID 46845709
(NE,S)-N-[(2S)-4-chloro-2-[(4-methoxyphenyl)methoxy]butylidene]-2-methylpropane-2-sulfinamide (PubChem CID 46845709) has the molecular formula C16H24ClNO3S and a molecular weight of 345.89 g/mol. Its IUPAC name is (NE,S)-N-[(2S)-4-chloro-2-[(4-methoxyphenyl)methoxy]butylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(2S)-4-chloro-2-[(4-methoxyphenyl)methoxy]butylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46845709 |
| Molecular Formula | C16H24ClNO3S |
| Molecular Weight | 345.89 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (NE,S)-N-[(2S)-4-chloro-2-[(4-methoxyphenyl)methoxy]butylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ccc(CO[C@H](/C=N/[S@@](=O)C(C)(C)C)CCCl)cc1 |
| InChI | InChI=1S/C16H24ClNO3S/c1-16(2,3)22(19)18-11-15(9-10-17)21-12-13-5-7-14(20-4)8-6-13/h5-8,11,15H,9-10,12H2,1-4H3/b18-11+/t15-,22-/m0/s1 |
| InChIKey | GIZFJVZFFSYNQA-WBMWLTQASA-N |
| XLogP | 3.74 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|