C31H53NO5SSi — CID 134962314
(NE,S)-N-[(2R,3E,5S,6E,10S,11R)-5-methoxy-11-[(4-methoxyphenyl)methoxy]-2,6,10-trimethyl-2-trimethylsilyloxydodeca-3,6-dienylidene]-2-methylpropane-2-sulfinamide (PubChem CID 134962314) has the molecular formula C31H53NO5SSi and a molecular weight of 579.92 g/mol. Its IUPAC name is (NE,S)-N-[(2R,3E,5S,6E,10S,11R)-5-methoxy-11-[(4-methoxyphenyl)methoxy]-2,6,10-trimethyl-2-trimethylsilyloxydodeca-3,6-dienylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(2R,3E,5S,6E,10S,11R)-5-methoxy-11-[(4-methoxyphenyl)methoxy]-2,6,10-trimethyl-2-trimethylsilyloxydodeca-3,6-dienylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134962314 |
| Molecular Formula | C31H53NO5SSi |
| Molecular Weight | 579.92 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | (NE,S)-N-[(2R,3E,5S,6E,10S,11R)-5-methoxy-11-[(4-methoxyphenyl)methoxy]-2,6,10-trimethyl-2-trimethylsilyloxydodeca-3,6-dienylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ccc(CO[C@H](C)[C@@H](C)CC/C=C(\C)[C@H](/C=C/[C@](C)(/C=N/[S@@](=O)C(C)(C)C)O[Si](C)(C)C)OC)cc1 |
| InChI | InChI=1S/C31H53NO5SSi/c1-24(26(3)36-22-27-16-18-28(34-8)19-17-27)14-13-15-25(2)29(35-9)20-21-31(7,37-39(10,11)12)23-32-38(33)30(4,5)6/h15-21,23-24,26,29H,13-14,22H2,1-12H3/b21-20+,25-15+,32-23+/t24-,26+,29-,31+,38-/m0/s1 |
| InChIKey | AQYLFWRZBPHLGL-PONYHQERSA-N |
| XLogP | 7.68 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.92 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|