C29H48O4SSi — CID 54752551
(3S,4S,7E,9E,11R,12S)-3-methoxy-11-[(4-methoxyphenyl)methoxy]-8,12-dimethyl-13-(2-trimethylsilylethylsulfanyl)trideca-1,7,9-trien-4-ol (PubChem CID 54752551) has the molecular formula C29H48O4SSi and a molecular weight of 520.85 g/mol. Its IUPAC name is (3S,4S,7E,9E,11R,12S)-3-methoxy-11-[(4-methoxyphenyl)methoxy]-8,12-dimethyl-13-(2-trimethylsilylethylsulfanyl)trideca-1,7,9-trien-4-ol.
| Compound Name | (3S,4S,7E,9E,11R,12S)-3-methoxy-11-[(4-methoxyphenyl)methoxy]-8,12-dimethyl-13-(2-trimethylsilylethylsulfanyl)trideca-1,7,9-trien-4-ol |
|---|---|
| PubChem CID | 54752551 |
| Molecular Formula | C29H48O4SSi |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (3S,4S,7E,9E,11R,12S)-3-methoxy-11-[(4-methoxyphenyl)methoxy]-8,12-dimethyl-13-(2-trimethylsilylethylsulfanyl)trideca-1,7,9-trien-4-ol |
| SMILES | C=C[C@H](OC)[C@@H](O)CC/C=C(C)/C=C/[C@@H](OCc1ccc(OC)cc1)[C@H](C)CSCC[Si](C)(C)C |
| InChI | InChI=1S/C29H48O4SSi/c1-9-28(32-5)27(30)12-10-11-23(2)13-18-29(24(3)22-34-19-20-35(6,7)8)33-21-25-14-16-26(31-4)17-15-25/h9,11,13-18,24,27-30H,1,10,12,19-22H2,2-8H3/b18-13+,23-11+/t24-,27+,28+,29-/m1/s1 |
| InChIKey | ZFKMIZICFGZIKM-QOMOJVEGSA-N |
| XLogP | 7.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|