C22H32O7 — CID 142724537
but-3-enyl (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-2-enoate (PubChem CID 142724537) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is but-3-enyl (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-2-enoate.
| Compound Name | but-3-enyl (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-2-enoate |
|---|---|
| PubChem CID | 142724537 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | but-3-enyl (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-[(4-methoxyphenyl)methoxy]hex-2-enoate |
| SMILES | C=CCCOC(=O)/C=C/[C@@H](OCOCCOC)[C@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H32O7/c1-5-6-13-27-22(23)12-11-21(29-17-26-15-14-24-3)18(2)28-16-19-7-9-20(25-4)10-8-19/h5,7-12,18,21H,1,6,13-17H2,2-4H3/b12-11+/t18-,21+/m0/s1 |
| InChIKey | OTWGVNBIKISQHX-CHEXVVPLSA-N |
| XLogP | 3.28 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|