C37H50O13S — CID 11204908
[(E,2S)-6-[2-(4-methylphenyl)sulfonylethoxy]-6-oxohex-4-en-2-yl] (E,4R,5S)-5-[(3S)-3-(2-methoxyethoxymethoxy)butanoyl]oxy-4-[(4-methoxyphenyl)methoxy]hex-2-enoate (PubChem CID 11204908) has the molecular formula C37H50O13S and a molecular weight of 734.86 g/mol. Its IUPAC name is [(E,2S)-6-[2-(4-methylphenyl)sulfonylethoxy]-6-oxohex-4-en-2-yl] (E,4R,5S)-5-[(3S)-3-(2-methoxyethoxymethoxy)butanoyl]oxy-4-[(4-methoxyphenyl)methoxy]hex-2-enoate.
| Compound Name | [(E,2S)-6-[2-(4-methylphenyl)sulfonylethoxy]-6-oxohex-4-en-2-yl] (E,4R,5S)-5-[(3S)-3-(2-methoxyethoxymethoxy)butanoyl]oxy-4-[(4-methoxyphenyl)methoxy]hex-2-enoate |
|---|---|
| PubChem CID | 11204908 |
| Molecular Formula | C37H50O13S |
| Molecular Weight | 734.86 g/mol |
| Exact Mass | 734.30 |
| IUPAC Name | [(E,2S)-6-[2-(4-methylphenyl)sulfonylethoxy]-6-oxohex-4-en-2-yl] (E,4R,5S)-5-[(3S)-3-(2-methoxyethoxymethoxy)butanoyl]oxy-4-[(4-methoxyphenyl)methoxy]hex-2-enoate |
| SMILES | COCCOCO[C@@H](C)CC(=O)O[C@@H](C)[C@@H](/C=C/C(=O)O[C@@H](C)C/C=C/C(=O)OCCS(=O)(=O)c1ccc(C)cc1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C37H50O13S/c1-27-10-16-33(17-11-27)51(41,42)23-22-46-35(38)9-7-8-28(2)49-36(39)19-18-34(47-25-31-12-14-32(44-6)15-13-31)30(4)50-37(40)24-29(3)48-26-45-21-20-43-5/h7,9-19,28-30,34H,8,20-26H2,1-6H3/b9-7+,19-18+/t28-,29-,30-,34+/m0/s1 |
| InChIKey | CDDICGTYMZHOQX-QEKNMCGUSA-N |
| XLogP | 4.69 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|