C24H35IO9 — CID 102258093
[(2S)-4-[(1E,3R)-1-iodo-2-methylhexa-1,5-dien-3-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate (PubChem CID 102258093) has the molecular formula C24H35IO9 and a molecular weight of 594.44 g/mol. Its IUPAC name is [(2S)-4-[(1E,3R)-1-iodo-2-methylhexa-1,5-dien-3-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate.
| Compound Name | [(2S)-4-[(1E,3R)-1-iodo-2-methylhexa-1,5-dien-3-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate |
|---|---|
| PubChem CID | 102258093 |
| Molecular Formula | C24H35IO9 |
| Molecular Weight | 594.44 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | [(2S)-4-[(1E,3R)-1-iodo-2-methylhexa-1,5-dien-3-yl]oxy-4-oxobutan-2-yl] (E,4R,5S)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhex-2-enoate |
| SMILES | C=CC[C@@H](OC(=O)C[C@H](C)OC(=O)/C=C/[C@@H](OCOCCOC)[C@H](C)OC(=O)C=C)/C(C)=C/I |
| InChI | InChI=1S/C24H35IO9/c1-7-9-20(17(3)15-25)34-24(28)14-18(4)32-23(27)11-10-21(19(5)33-22(26)8-2)31-16-30-13-12-29-6/h7-8,10-11,15,18-21H,1-2,9,12-14,16H2,3-6H3/b11-10+,17-15+/t18-,19-,20+,21+/m0/s1 |
| InChIKey | HQTDDDPFNXDVGT-SVNYGXOASA-N |
| XLogP | 3.81 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|