C28H42O9 — CID 102300465
[(2R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-en-2-yl] (4R,5R)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhexanoate (PubChem CID 102300465) has the molecular formula C28H42O9 and a molecular weight of 522.64 g/mol. Its IUPAC name is [(2R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-en-2-yl] (4R,5R)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhexanoate.
| Compound Name | [(2R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-en-2-yl] (4R,5R)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 102300465 |
| Molecular Formula | C28H42O9 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | [(2R,5R)-5-[(4-methoxyphenyl)methoxy]hept-6-en-2-yl] (4R,5R)-4-(2-methoxyethoxymethoxy)-5-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)O[C@H](C)[C@@H](CCC(=O)O[C@H](C)CC[C@H](C=C)OCc1ccc(OC)cc1)OCOCCOC |
| InChI | InChI=1S/C28H42O9/c1-7-24(34-19-23-10-13-25(32-6)14-11-23)12-9-21(3)36-28(30)16-15-26(22(4)37-27(29)8-2)35-20-33-18-17-31-5/h7-8,10-11,13-14,21-22,24,26H,1-2,9,12,15-20H2,3-6H3/t21-,22-,24+,26-/m1/s1 |
| InChIKey | GWMVGCGNXGYKMC-WUUJFSMWSA-N |
| XLogP | 4.38 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|