C30H38O6 — CID 134850965
[(2R,5S)-5-phenylmethoxyhept-6-en-2-yl] (4S,5R)-4-phenylmethoxy-5-prop-2-enoyloxyhexanoate (PubChem CID 134850965) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is [(2R,5S)-5-phenylmethoxyhept-6-en-2-yl] (4S,5R)-4-phenylmethoxy-5-prop-2-enoyloxyhexanoate.
| Compound Name | [(2R,5S)-5-phenylmethoxyhept-6-en-2-yl] (4S,5R)-4-phenylmethoxy-5-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 134850965 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [(2R,5S)-5-phenylmethoxyhept-6-en-2-yl] (4S,5R)-4-phenylmethoxy-5-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)O[C@H](C)[C@H](CCC(=O)O[C@H](C)CC[C@@H](C=C)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H38O6/c1-5-27(33-21-25-13-9-7-10-14-25)18-17-23(3)35-30(32)20-19-28(24(4)36-29(31)6-2)34-22-26-15-11-8-12-16-26/h5-16,23-24,27-28H,1-2,17-22H2,3-4H3/t23-,24-,27-,28+/m1/s1 |
| InChIKey | VDTOLFBIPWACLS-CDORBJOZSA-N |
| XLogP | 5.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|