C16H22O3 — CID 46186042
(7R,8R)-7-hydroxy-8-phenylmethoxynon-1-en-3-one (PubChem CID 46186042) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (7R,8R)-7-hydroxy-8-phenylmethoxynon-1-en-3-one.
| Compound Name | (7R,8R)-7-hydroxy-8-phenylmethoxynon-1-en-3-one |
|---|---|
| PubChem CID | 46186042 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (7R,8R)-7-hydroxy-8-phenylmethoxynon-1-en-3-one |
| SMILES | C=CC(=O)CCC[C@@H](O)[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O3/c1-3-15(17)10-7-11-16(18)13(2)19-12-14-8-5-4-6-9-14/h3-6,8-9,13,16,18H,1,7,10-12H2,2H3/t13-,16-/m1/s1 |
| InChIKey | PWDHNPKRRBHQOL-CZUORRHYSA-N |
| XLogP | 2.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|