C20H24O2 — CID 57030159
(2S,3S)-3-phenylmethoxy-1-(2-prop-2-enylphenyl)butan-2-ol (PubChem CID 57030159) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S,3S)-3-phenylmethoxy-1-(2-prop-2-enylphenyl)butan-2-ol.
| Compound Name | (2S,3S)-3-phenylmethoxy-1-(2-prop-2-enylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 57030159 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2S,3S)-3-phenylmethoxy-1-(2-prop-2-enylphenyl)butan-2-ol |
| SMILES | C=CCc1ccccc1C[C@H](O)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-3-9-18-12-7-8-13-19(18)14-20(21)16(2)22-15-17-10-5-4-6-11-17/h3-8,10-13,16,20-21H,1,9,14-15H2,2H3/t16-,20-/m0/s1 |
| InChIKey | IZCGRKFAJRROGV-JXFKEZNVSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|