C22H24O2 — CID 57321321
(3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-ol (PubChem CID 57321321) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-ol.
| Compound Name | (3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-ol |
|---|---|
| PubChem CID | 57321321 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-ol |
| SMILES | C[C@H](OCc1ccccc1)[C@H](O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C22H24O2/c1-17(24-16-18-8-3-2-4-9-18)22(23)15-14-20-12-7-11-19-10-5-6-13-21(19)20/h2-13,17,22-23H,14-16H2,1H3/t17-,22+/m0/s1 |
| InChIKey | KQSPDXNOIQGLLZ-HTAPYJJXSA-N |
| XLogP | 4.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |