C26H27N3O2 — CID 57324110
1-[(3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-yl]imidazole-4-carboxamide (PubChem CID 57324110) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[(3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 57324110 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[(3R,4S)-1-naphthalen-1-yl-4-phenylmethoxypentan-3-yl]imidazole-4-carboxamide |
| SMILES | C[C@H](OCc1ccccc1)[C@@H](CCc1cccc2ccccc12)n1cnc(C(N)=O)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-19(31-17-20-8-3-2-4-9-20)25(29-16-24(26(27)30)28-18-29)15-14-22-12-7-11-21-10-5-6-13-23(21)22/h2-13,16,18-19,25H,14-15,17H2,1H3,(H2,27,30)/t19-,25+/m0/s1 |
| InChIKey | UNICGWLCMLNZES-UQBPGWFLSA-N |
| XLogP | 4.91 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |