C20H24O2 — CID 121344680
(2S,3R,4S)-4-benzyl-2-phenylmethoxyhex-5-en-3-ol (PubChem CID 121344680) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (2S,3R,4S)-4-benzyl-2-phenylmethoxyhex-5-en-3-ol.
| Compound Name | (2S,3R,4S)-4-benzyl-2-phenylmethoxyhex-5-en-3-ol |
|---|---|
| PubChem CID | 121344680 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2S,3R,4S)-4-benzyl-2-phenylmethoxyhex-5-en-3-ol |
| SMILES | C=C[C@H](Cc1ccccc1)[C@@H](O)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-3-19(14-17-10-6-4-7-11-17)20(21)16(2)22-15-18-12-8-5-9-13-18/h3-13,16,19-21H,1,14-15H2,2H3/t16-,19+,20-/m0/s1 |
| InChIKey | JTOLBDHYIYFIFW-DBVUQKKJSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|