C21H26O3 — CID 118194675
(3S,4R,5S)-4-benzyl-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol (PubChem CID 118194675) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3S,4R,5S)-4-benzyl-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol.
| Compound Name | (3S,4R,5S)-4-benzyl-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol |
|---|---|
| PubChem CID | 118194675 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (3S,4R,5S)-4-benzyl-5-[(4-methoxyphenyl)methoxy]hex-1-en-3-ol |
| SMILES | C=C[C@H](O)[C@@H](Cc1ccccc1)[C@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26O3/c1-4-21(22)20(14-17-8-6-5-7-9-17)16(2)24-15-18-10-12-19(23-3)13-11-18/h4-13,16,20-22H,1,14-15H2,2-3H3/t16-,20-,21-/m0/s1 |
| InChIKey | SFVZOBALDSKTFR-NDXORKPFSA-N |
| XLogP | 4.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|