C20H22FeO6 — CID 11037076
carbon monoxide;(2S,3S,6E,8E)-3-hydroxy-2-phenylmethoxydeca-6,8-dien-5-one;iron (PubChem CID 11037076) has the molecular formula C20H22FeO6 and a molecular weight of 414.24 g/mol. Its IUPAC name is carbon monoxide;(2S,3S,6E,8E)-3-hydroxy-2-phenylmethoxydeca-6,8-dien-5-one;iron.
| Compound Name | carbon monoxide;(2S,3S,6E,8E)-3-hydroxy-2-phenylmethoxydeca-6,8-dien-5-one;iron |
|---|---|
| PubChem CID | 11037076 |
| Molecular Formula | C20H22FeO6 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | carbon monoxide;(2S,3S,6E,8E)-3-hydroxy-2-phenylmethoxydeca-6,8-dien-5-one;iron |
| SMILES | C/C=C/C=C/C(=O)C[C@H](O)[C@H](C)OCc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C17H22O3.3CO.Fe/c1-3-4-6-11-16(18)12-17(19)14(2)20-13-15-9-7-5-8-10-15;3*1-2;/h3-11,14,17,19H,12-13H2,1-2H3;;;;/b4-3+,11-6+;;;;/t14-,17-;;;;/m0..../s1 |
| InChIKey | GNFHTTPDKNSYCW-VGIGRIBQSA-N |
| XLogP | 2.93 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|