C18H18FeO5 — CID 11291643
carbon monoxide;(1S,2R,4E,6E)-1-hydroxy-2-methyl-1-phenylocta-4,6-dien-3-one;iron (PubChem CID 11291643) has the molecular formula C18H18FeO5 and a molecular weight of 370.18 g/mol. Its IUPAC name is carbon monoxide;(1S,2R,4E,6E)-1-hydroxy-2-methyl-1-phenylocta-4,6-dien-3-one;iron.
| Compound Name | carbon monoxide;(1S,2R,4E,6E)-1-hydroxy-2-methyl-1-phenylocta-4,6-dien-3-one;iron |
|---|---|
| PubChem CID | 11291643 |
| Molecular Formula | C18H18FeO5 |
| Molecular Weight | 370.18 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | carbon monoxide;(1S,2R,4E,6E)-1-hydroxy-2-methyl-1-phenylocta-4,6-dien-3-one;iron |
| SMILES | C/C=C/C=C/C(=O)[C@H](C)[C@H](O)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C15H18O2.3CO.Fe/c1-3-4-6-11-14(16)12(2)15(17)13-9-7-5-8-10-13;3*1-2;/h3-12,15,17H,1-2H3;;;;/b4-3+,11-6+;;;;/t12-,15-;;;;/m0..../s1 |
| InChIKey | CEBHTNCOSHBTHL-DDJGXCRLSA-N |
| XLogP | 2.94 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|