C13H17NO5 — CID 76960503
(1R,2S)-2-amino-1-phenylpropan-1-ol;(Z)-but-2-enedioic acid (PubChem CID 76960503) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-phenylpropan-1-ol;(Z)-but-2-enedioic acid.
| Compound Name | (1R,2S)-2-amino-1-phenylpropan-1-ol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 76960503 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (1R,2S)-2-amino-1-phenylpropan-1-ol;(Z)-but-2-enedioic acid |
| SMILES | C[C@H](N)[C@H](O)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C9H13NO.C4H4O4/c1-7(10)9(11)8-5-3-2-4-6-8;5-3(6)1-2-4(7)8/h2-7,9,11H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t7-,9-;/m0./s1 |
| InChIKey | PMRCIPUNYJFMII-LBTDPVFMSA-N |
| XLogP | 0.78 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|