C22H31ClN2O4 — CID 165079516
acetyl chloride;(1R,2S)-2-amino-1-phenylpropan-1-ol;N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide (PubChem CID 165079516) has the molecular formula C22H31ClN2O4 and a molecular weight of 422.95 g/mol. Its IUPAC name is acetyl chloride;(1R,2S)-2-amino-1-phenylpropan-1-ol;N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide.
| Compound Name | acetyl chloride;(1R,2S)-2-amino-1-phenylpropan-1-ol;N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 165079516 |
| Molecular Formula | C22H31ClN2O4 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | acetyl chloride;(1R,2S)-2-amino-1-phenylpropan-1-ol;N-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide |
| SMILES | CC(=O)Cl.CC(=O)N[C@@H](C)[C@H](O)c1ccccc1.C[C@H](N)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C9H13NO.C2H3ClO/c1-8(12-9(2)13)11(14)10-6-4-3-5-7-10;1-7(10)9(11)8-5-3-2-4-6-8;1-2(3)4/h3-8,11,14H,1-2H3,(H,12,13);2-7,9,11H,10H2,1H3;1H3/t8-,11-;7-,9-;/m00./s1 |
| InChIKey | UWQPFKBAMKJVBA-IGPASJCISA-N |
| XLogP | 3.08 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|