C21H37N3O3 — CID 174827911
(1S,2R)-2-amino-1-phenylpropan-1-ol;N'-hexylhexanediamide (PubChem CID 174827911) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-phenylpropan-1-ol;N'-hexylhexanediamide.
| Compound Name | (1S,2R)-2-amino-1-phenylpropan-1-ol;N'-hexylhexanediamide |
|---|---|
| PubChem CID | 174827911 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | (1S,2R)-2-amino-1-phenylpropan-1-ol;N'-hexylhexanediamide |
| SMILES | CCCCCCNC(=O)CCCCC(N)=O.C[C@@H](N)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C12H24N2O2.C9H13NO/c1-2-3-4-7-10-14-12(16)9-6-5-8-11(13)15;1-7(10)9(11)8-5-3-2-4-6-8/h2-10H2,1H3,(H2,13,15)(H,14,16);2-7,9,11H,10H2,1H3/t;7-,9-/m.1/s1 |
| InChIKey | ARRVYDGKPOTJAW-DYCOFXLNSA-N |
| XLogP | 2.80 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|