C19H22N2O5 — CID 161238687
(2R)-2-[amino(methyl)amino]-1,2-diphenylethanol;(Z)-but-2-enedioic acid (PubChem CID 161238687) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2R)-2-[amino(methyl)amino]-1,2-diphenylethanol;(Z)-but-2-enedioic acid.
| Compound Name | (2R)-2-[amino(methyl)amino]-1,2-diphenylethanol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 161238687 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2R)-2-[amino(methyl)amino]-1,2-diphenylethanol;(Z)-but-2-enedioic acid |
| SMILES | CN(N)[C@H](c1ccccc1)C(O)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H18N2O.C4H4O4/c1-17(16)14(12-8-4-2-5-9-12)15(18)13-10-6-3-7-11-13;5-3(6)1-2-4(7)8/h2-11,14-15,18H,16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,15?;/m1./s1 |
| InChIKey | RCRMNKDMXUYVBC-XYVADVQMSA-N |
| XLogP | 1.98 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|