C15H20N4O — CID 174865335
1,1-diaminourea;1-phenylethylbenzene (PubChem CID 174865335) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 1,1-diaminourea;1-phenylethylbenzene.
| Compound Name | 1,1-diaminourea;1-phenylethylbenzene |
|---|---|
| PubChem CID | 174865335 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1,1-diaminourea;1-phenylethylbenzene |
| SMILES | CC(c1ccccc1)c1ccccc1.NC(=O)N(N)N |
| InChI | InChI=1S/C14H14.CH6N4O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;2-1(6)5(3)4/h2-12H,1H3;3-4H2,(H2,2,6) |
| InChIKey | BKRMPXJIHINIDN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|