About CID 100998329
CID 100998329 (PubChem CID 100998329) has the molecular formula C18H22NO2
and a molecular weight of 284.38 g/mol.
Molecular Properties
| Compound Name | CID 100998329 |
| PubChem CID | 100998329 |
| Molecular Formula | C18H22NO2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N([O])C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C18H22NO2/c1-18(2,3)19(21)16(14-10-6-4-7-11-14)17(20)15-12-8-5-9-13-15/h4-13,16-17,20H,1-3H3 |
| InChIKey | KFSZRBYAAMDILW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 100998329 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 100998329?
The IUPAC name of CID 100998329 (CID 100998329) is not available.
What is the SMILES notation for CID 100998329?
The canonical SMILES for CID 100998329 is CC(C)(C)N([O])C(c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of CID 100998329?
The InChIKey is KFSZRBYAAMDILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22NO2/c1-18(2,3)19(21)16(14-10-6-4-7-11-14)17(20)15-12-8-5-9-13-15/h4-13,16-17,20H,1-3H3.
What are the key properties of CID 100998329?
CID 100998329 has a molecular weight of 284.38 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 100998329 is sourced from PubChem (CID 100998329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).