C15H22NO3 — CID 132607463
CID 132607463 (PubChem CID 132607463) has the molecular formula C15H22NO3 and a molecular weight of 264.34 g/mol.
| Compound Name | CID 132607463 |
|---|---|
| PubChem CID | 132607463 |
| Molecular Formula | C15H22NO3 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | — |
| SMILES | CC(C)C(c1ccccc1)N([O])C(C)(C)CC(=O)O |
| InChI | InChI=1S/C15H22NO3/c1-11(2)14(12-8-6-5-7-9-12)16(19)15(3,4)10-13(17)18/h5-9,11,14H,10H2,1-4H3,(H,17,18) |
| InChIKey | BOYBBTGCGLEWNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|