C16H24NO3- — CID 140706005
3-[methoxy-(2-methyl-1-phenylpropyl)amino]-3-methylbutanoate (PubChem CID 140706005) has the molecular formula C16H24NO3- and a molecular weight of 278.37 g/mol. Its IUPAC name is 3-[methoxy-(2-methyl-1-phenylpropyl)amino]-3-methylbutanoate.
| Compound Name | 3-[methoxy-(2-methyl-1-phenylpropyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 140706005 |
| Molecular Formula | C16H24NO3- |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-[methoxy-(2-methyl-1-phenylpropyl)amino]-3-methylbutanoate |
| SMILES | CON(C(c1ccccc1)C(C)C)C(C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C16H25NO3/c1-12(2)15(13-9-7-6-8-10-13)17(20-5)16(3,4)11-14(18)19/h6-10,12,15H,11H2,1-5H3,(H,18,19)/p-1 |
| InChIKey | LIDYZZPHOPBJHM-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|