C29H43NO4 — CID 140958039
butyl 2-[(1-hydroxy-2-methylpropan-2-yl)-(2-methyl-1-phenylpropyl)amino]oxy-4-phenylpentanoate (PubChem CID 140958039) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is butyl 2-[(1-hydroxy-2-methylpropan-2-yl)-(2-methyl-1-phenylpropyl)amino]oxy-4-phenylpentanoate.
| Compound Name | butyl 2-[(1-hydroxy-2-methylpropan-2-yl)-(2-methyl-1-phenylpropyl)amino]oxy-4-phenylpentanoate |
|---|---|
| PubChem CID | 140958039 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | butyl 2-[(1-hydroxy-2-methylpropan-2-yl)-(2-methyl-1-phenylpropyl)amino]oxy-4-phenylpentanoate |
| SMILES | CCCCOC(=O)C(CC(C)c1ccccc1)ON(C(c1ccccc1)C(C)C)C(C)(C)CO |
| InChI | InChI=1S/C29H43NO4/c1-7-8-19-33-28(32)26(20-23(4)24-15-11-9-12-16-24)34-30(29(5,6)21-31)27(22(2)3)25-17-13-10-14-18-25/h9-18,22-23,26-27,31H,7-8,19-21H2,1-6H3 |
| InChIKey | ZRVNBKLMEOMQTD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|