C21H34O3 — CID 174975503
butyl 3-tert-butyl-3-hydroxy-4,4-dimethyl-2-phenylpentanoate (PubChem CID 174975503) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is butyl 3-tert-butyl-3-hydroxy-4,4-dimethyl-2-phenylpentanoate.
| Compound Name | butyl 3-tert-butyl-3-hydroxy-4,4-dimethyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 174975503 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | butyl 3-tert-butyl-3-hydroxy-4,4-dimethyl-2-phenylpentanoate |
| SMILES | CCCCOC(=O)C(c1ccccc1)C(O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3/c1-8-9-15-24-18(22)17(16-13-11-10-12-14-16)21(23,19(2,3)4)20(5,6)7/h10-14,17,23H,8-9,15H2,1-7H3 |
| InChIKey | QDVNMZJXTVLOSH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|