C30H45NO3 — CID 59132546
tert-butyl 4-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-ethyl-4-phenylbutanoate (PubChem CID 59132546) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-ethyl-4-phenylbutanoate.
| Compound Name | tert-butyl 4-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-ethyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 59132546 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | tert-butyl 4-[tert-butyl-(2-methyl-1-phenylpropyl)amino]oxy-2-ethyl-4-phenylbutanoate |
| SMILES | CCC(CC(ON(C(c1ccccc1)C(C)C)C(C)(C)C)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45NO3/c1-10-23(28(32)33-30(7,8)9)21-26(24-17-13-11-14-18-24)34-31(29(4,5)6)27(22(2)3)25-19-15-12-16-20-25/h11-20,22-23,26-27H,10,21H2,1-9H3 |
| InChIKey | XEHVXIXJNQUYLZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|