C17H27NO3 — CID 141349315
3-[tert-butyl(1-phenylethoxy)amino]-3-methylbutanoic acid (PubChem CID 141349315) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[tert-butyl(1-phenylethoxy)amino]-3-methylbutanoic acid.
| Compound Name | 3-[tert-butyl(1-phenylethoxy)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 141349315 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-[tert-butyl(1-phenylethoxy)amino]-3-methylbutanoic acid |
| SMILES | CC(ON(C(C)(C)C)C(C)(C)CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H27NO3/c1-13(14-10-8-7-9-11-14)21-18(16(2,3)4)17(5,6)12-15(19)20/h7-11,13H,12H2,1-6H3,(H,19,20) |
| InChIKey | OLFZMTPLHBYYCI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|