C14H15BrO2 — CID 15529073
(1S,2R,4E,6E)-2-bromo-1-hydroxy-1-phenylocta-4,6-dien-3-one (PubChem CID 15529073) has the molecular formula C14H15BrO2 and a molecular weight of 295.18 g/mol. Its IUPAC name is (1S,2R,4E,6E)-2-bromo-1-hydroxy-1-phenylocta-4,6-dien-3-one.
| Compound Name | (1S,2R,4E,6E)-2-bromo-1-hydroxy-1-phenylocta-4,6-dien-3-one |
|---|---|
| PubChem CID | 15529073 |
| Molecular Formula | C14H15BrO2 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (1S,2R,4E,6E)-2-bromo-1-hydroxy-1-phenylocta-4,6-dien-3-one |
| SMILES | C/C=C/C=C/C(=O)[C@H](Br)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H15BrO2/c1-2-3-5-10-12(16)13(15)14(17)11-8-6-4-7-9-11/h2-10,13-14,17H,1H3/b3-2+,10-5+/t13-,14-/m0/s1 |
| InChIKey | DVTZFSLASQETPW-CXKURIPNSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|