C14H19NO — CID 123456345
1-amino-1-phenylocta-4,6-dien-2-ol (PubChem CID 123456345) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-amino-1-phenylocta-4,6-dien-2-ol.
| Compound Name | 1-amino-1-phenylocta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 123456345 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-amino-1-phenylocta-4,6-dien-2-ol |
| SMILES | CC=CC=CCC(O)C(N)c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-2-3-4-8-11-13(16)14(15)12-9-6-5-7-10-12/h2-10,13-14,16H,11,15H2,1H3 |
| InChIKey | LRTNIAYYQNSXMX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|