C24H24P+ — CID 13156160
[(2Z,4E)-hexa-2,4-dienyl]-triphenylphosphanium (PubChem CID 13156160) has the molecular formula C24H24P+ and a molecular weight of 343.43 g/mol. Its IUPAC name is [(2Z,4E)-hexa-2,4-dienyl]-triphenylphosphanium.
| Compound Name | [(2Z,4E)-hexa-2,4-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 13156160 |
| Molecular Formula | C24H24P+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(2Z,4E)-hexa-2,4-dienyl]-triphenylphosphanium |
| SMILES | C/C=C/C=C\C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24P/c1-2-3-4-14-21-25(22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24/h2-20H,21H2,1H3/q+1/b3-2+,14-4- |
| InChIKey | ZXSGONDRIULTLD-YFBKQRKCSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|