C18H26 — CID 156727063
[(7Z,9Z)-2-methylundeca-7,9-dien-5-yl]benzene (PubChem CID 156727063) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is [(7Z,9Z)-2-methylundeca-7,9-dien-5-yl]benzene.
| Compound Name | [(7Z,9Z)-2-methylundeca-7,9-dien-5-yl]benzene |
|---|---|
| PubChem CID | 156727063 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | [(7Z,9Z)-2-methylundeca-7,9-dien-5-yl]benzene |
| SMILES | C/C=C\C=C/CC(CCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H26/c1-4-5-6-8-13-18(15-14-16(2)3)17-11-9-7-10-12-17/h4-12,16,18H,13-15H2,1-3H3/b5-4-,8-6- |
| InChIKey | XTCJCGMOGGIMPH-NADLECRISA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|