C20H24 — CID 91290814
5-(1-phenylhepta-3,5-dienyl)cyclohepta-1,3-diene (PubChem CID 91290814) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is 5-(1-phenylhepta-3,5-dienyl)cyclohepta-1,3-diene.
| Compound Name | 5-(1-phenylhepta-3,5-dienyl)cyclohepta-1,3-diene |
|---|---|
| PubChem CID | 91290814 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 5-(1-phenylhepta-3,5-dienyl)cyclohepta-1,3-diene |
| SMILES | CC=CC=CCC(c1ccccc1)C1C=CC=CCC1 |
| InChI | InChI=1S/C20H24/c1-2-3-4-12-17-20(19-15-10-7-11-16-19)18-13-8-5-6-9-14-18/h2-8,10-13,15-16,18,20H,9,14,17H2,1H3 |
| InChIKey | WVRMREFVXZUWIH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|