C13H13I — CID 89349773
[cyclohexa-2,4-dien-1-yl(iodo)methyl]benzene (PubChem CID 89349773) has the molecular formula C13H13I and a molecular weight of 296.15 g/mol. Its IUPAC name is [cyclohexa-2,4-dien-1-yl(iodo)methyl]benzene.
| Compound Name | [cyclohexa-2,4-dien-1-yl(iodo)methyl]benzene |
|---|---|
| PubChem CID | 89349773 |
| Molecular Formula | C13H13I |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | [cyclohexa-2,4-dien-1-yl(iodo)methyl]benzene |
| SMILES | IC(c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C13H13I/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-9,12-13H,10H2 |
| InChIKey | FHGHMQHHKBNAKP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|