C13H13FO — CID 16680302
(R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanol (PubChem CID 16680302) has the molecular formula C13H13FO and a molecular weight of 204.24 g/mol. Its IUPAC name is (R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanol.
| Compound Name | (R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 16680302 |
| Molecular Formula | C13H13FO |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (R)-[(1S)-cyclohexa-2,4-dien-1-yl]-(4-fluorophenyl)methanol |
| SMILES | O[C@@H](c1ccc(F)cc1)[C@@H]1C=CC=CC1 |
| InChI | InChI=1S/C13H13FO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-4,6-10,13,15H,5H2/t10-,13-/m1/s1 |
| InChIKey | XXAOMVHTOYUXIL-ZWNOBZJWSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |