C13H17FOS2 — CID 115386459
(3-ethyl-1,4-dithian-2-yl)-(4-fluorophenyl)methanol (PubChem CID 115386459) has the molecular formula C13H17FOS2 and a molecular weight of 272.41 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-(4-fluorophenyl)methanol.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 115386459 |
| Molecular Formula | C13H17FOS2 |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-(4-fluorophenyl)methanol |
| SMILES | CCC1SCCSC1C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FOS2/c1-2-11-13(17-8-7-16-11)12(15)9-3-5-10(14)6-4-9/h3-6,11-13,15H,2,7-8H2,1H3 |
| InChIKey | ZEBLNHRZENANDM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |