C13H22N2OS2 — CID 113299465
(3-ethyl-1,4-dithian-2-yl)-(1-propylpyrazol-4-yl)methanol (PubChem CID 113299465) has the molecular formula C13H22N2OS2 and a molecular weight of 286.47 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-(1-propylpyrazol-4-yl)methanol.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-(1-propylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 113299465 |
| Molecular Formula | C13H22N2OS2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-(1-propylpyrazol-4-yl)methanol |
| SMILES | CCCn1cc(C(O)C2SCCSC2CC)cn1 |
| InChI | InChI=1S/C13H22N2OS2/c1-3-5-15-9-10(8-14-15)12(16)13-11(4-2)17-6-7-18-13/h8-9,11-13,16H,3-7H2,1-2H3 |
| InChIKey | JBZYBJQFNRMCBI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |