C11H18N2O2S — CID 79962789
1,4-oxathian-2-yl-(1-propylpyrazol-4-yl)methanol (PubChem CID 79962789) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1,4-oxathian-2-yl-(1-propylpyrazol-4-yl)methanol.
| Compound Name | 1,4-oxathian-2-yl-(1-propylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 79962789 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 1,4-oxathian-2-yl-(1-propylpyrazol-4-yl)methanol |
| SMILES | CCCn1cc(C(O)C2CSCCO2)cn1 |
| InChI | InChI=1S/C11H18N2O2S/c1-2-3-13-7-9(6-12-13)11(14)10-8-16-5-4-15-10/h6-7,10-11,14H,2-5,8H2,1H3 |
| InChIKey | GCBMJYSQCKBGLB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |